* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FENABUTENE |
CAS: | 5984-83-8 |
English Synonyms: | FENABUTENE |
MDL Number.: | MFCD00868824 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C/C=C(\C)/c1ccc(cc1)OC(=O)C |
InChi: | InChI=1S/C12H14O2/c1-4-9(2)11-5-7-12(8-6-11)14-10(3)13/h4-8H,1-3H3/b9-4+ |
InChiKey: | InChIKey=SALPXBRLSNRTNE-RUDMXATFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.