* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUZADOLANE |
CAS: | 115762-17-9 |
English Synonyms: | RUZADOLANE |
MDL Number.: | MFCD00868830 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | c1ccn2c(c1)nnc2SCCN3CCN(CC3)c4ccc(cc4F)F |
InChi: | InChI=1S/C18H19F2N5S/c19-14-4-5-16(15(20)13-14)24-9-7-23(8-10-24)11-12-26-18-22-21-17-3-1-2-6-25(17)18/h1-6,13H,7-12H2 |
InChiKey: | InChIKey=LOKBLLCVOKCEFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.