* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROFELODINE |
CAS: | 76696-97-4 |
English Synonyms: | ROFELODINE |
MDL Number.: | MFCD00868856 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C2CC3=NCCC(=O)N3C2 |
InChi: | InChI=1S/C13H14N2O/c16-13-6-7-14-12-8-11(9-15(12)13)10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
InChiKey: | InChIKey=JFKIAPMUYQUVHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.