* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUVAZONE |
CAS: | 20228-27-7 |
English Synonyms: | RUVAZONE |
MDL Number.: | MFCD00868889 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOc1ccccc1C(=O)N/N=C(\C)/C(=O)O |
InChi: | InChI=1S/C12H14N2O4/c1-3-18-10-7-5-4-6-9(10)11(15)14-13-8(2)12(16)17/h4-7H,3H2,1-2H3,(H,14,15)(H,16,17)/b13-8+ |
InChiKey: | InChIKey=ACONNXZOJIHEHN-MDWZMJQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.