* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURALAZINE |
CAS: | 556-12-7 |
English Synonyms: | FURALAZINE |
MDL Number.: | MFCD00868902 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | c1cc(oc1/C=C/c2cnc(nn2)N)[N+](=O)[O-] |
InChi: | InChI=1S/C9H7N5O3/c10-9-11-5-6(12-13-9)1-2-7-3-4-8(17-7)14(15)16/h1-5H,(H2,10,11,13)/b2-1+ |
InChiKey: | InChIKey=RWOLIGKRDWLZSV-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.