* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULICRINAT |
| CAS: | 90207-12-8 |
| English Synonyms: | SULICRINAT |
| MDL Number.: | MFCD00868964 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cc(c(cc1C(=O)c2ccc(c(c2Cl)Cl)OCC(=O)O)S(=O)(=O)N)Cl |
| InChi: | InChI=1S/C15H10Cl3NO6S/c16-9-3-1-7(5-11(9)26(19,23)24)15(22)8-2-4-10(14(18)13(8)17)25-6-12(20)21/h1-5H,6H2,(H,20,21)(H2,19,23,24) |
| InChiKey: | InChIKey=REORSPZOQXYWIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.