* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GEMAZOCINE |
| CAS: | 54063-47-7 |
| English Synonyms: | GEMAZOCINE |
| MDL Number.: | MFCD00869040 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC12CCN(C(C1(C)C)Cc3c2cc(cc3)O)CC4CC4 |
| InChi: | InChI=1S/C20H29NO/c1-4-20-9-10-21(13-14-5-6-14)18(19(20,2)3)11-15-7-8-16(22)12-17(15)20/h7-8,12,14,18,22H,4-6,9-11,13H2,1-3H3 |
| InChiKey: | InChIKey=AFZOCGNTFCGOEE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.