* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SUNAGREL |
| CAS: | 85418-85-5 ;85418-86-6 |
| English Synonyms: | SUNAGREL |
| MDL Number.: | MFCD00869099 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)Sc1ccc(cc1)[C@@H]([C@@H](C)N2CCN(CC2)C(=O)/C=C/c3ccccc3)O |
| InChi: | InChI=1S/C25H32N2O2S/c1-19(2)30-23-12-10-22(11-13-23)25(29)20(3)26-15-17-27(18-16-26)24(28)14-9-21-7-5-4-6-8-21/h4-14,19-20,25,29H,15-18H2,1-3H3/b14-9+/t20-,25-/m1/s1 |
| InChiKey: | InChIKey=UUHFEOMKFKXLCB-VPBAMMSTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.