* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLIPALAMIDE |
| CAS: | 37598-94-0 |
| English Synonyms: | GLIPALAMIDE |
| MDL Number.: | MFCD00869166 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)S(=O)(=O)NC(=O)N2C(CC=N2)C |
| InChi: | InChI=1S/C12H15N3O3S/c1-9-3-5-11(6-4-9)19(17,18)14-12(16)15-10(2)7-8-13-15/h3-6,8,10H,7H2,1-2H3,(H,14,16) |
| InChiKey: | InChIKey=OUUYOZGHNAGYNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.