* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | REPOSAL |
CAS: | 3625-25-0 |
English Synonyms: | REPOSAL |
MDL Number.: | MFCD00869207 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCC1(C(=O)NC(=O)NC1=O)C2=C[C@@H]3CC[C@@H](C3)C2 |
InChi: | InChI=1S/C14H18N2O3/c1-2-14(11(17)15-13(19)16-12(14)18)10-6-8-3-4-9(5-8)7-10/h6,8-9H,2-5,7H2,1H3,(H2,15,16,17,18,19)/t8-,9+/m1/s1 |
InChiKey: | InChIKey=MKELYWOVSPVORM-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.