* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FK973 |
CAS: | 113202-60-1 ;114580-45-9 |
English Synonyms: | FK973 |
MDL Number.: | MFCD00869373 |
H bond acceptor: | 12 |
H bond donor: | 1 |
Smile: | CC(=O)N1C2C1C3(C(c4c(cc(cc4OC(=O)C)C=O)N(C2)O3)COC(=O)N)OC(=O)C |
InChi: | InChI=1S/C20H21N3O9/c1-9(25)23-15-6-22-14-4-12(7-24)5-16(30-10(2)26)17(14)13(8-29-19(21)28)20(32-22,18(15)23)31-11(3)27/h4-5,7,13,15,18H,6,8H2,1-3H3,(H2,21,28) |
InChiKey: | InChIKey=FBXPCVIKIBWXAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.