* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHINOL |
| CAS: | 2530-97-4 |
| English Synonyms: | XANTHINOL |
| MDL Number.: | MFCD00869448 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | Cn1c2c(c(=O)n(c1=O)C)n(cn2)CC(CN(C)CCO)O |
| InChi: | InChI=1S/C13H21N5O4/c1-15(4-5-19)6-9(20)7-18-8-14-11-10(18)12(21)17(3)13(22)16(11)2/h8-9,19-20H,4-7H2,1-3H3 |
| InChiKey: | InChIKey=DSFGXPJYDCSWTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.