* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IP 66 |
CAS: | 58013-09-5 |
English Synonyms: | 1-[2-ETHOXY-2-(3-PYRIDINYL)ETHYL]-4-(2-METHOXYPHENYL)-PIPERAZINE ; IP 66 |
MDL Number.: | MFCD00869502 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOC(CN1CCN(CC1)c2ccccc2OC)c3cccnc3 |
InChi: | InChI=1S/C20H27N3O2/c1-3-25-20(17-7-6-10-21-15-17)16-22-11-13-23(14-12-22)18-8-4-5-9-19(18)24-2/h4-10,15,20H,3,11-14,16H2,1-2H3 |
InChiKey: | InChIKey=FFKRVMYEUOOFBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.