* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-HYDROXYHALAZEPAM |
CAS: | 22753-75-9 |
English Synonyms: | 3-HYDROXYHALAZEPAM |
MDL Number.: | MFCD00869661 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C2=NC(C(=O)N(c3c2cc(cc3)Cl)CC(F)(F)F)O |
InChi: | InChI=1S/C17H12ClF3N2O2/c18-11-6-7-13-12(8-11)14(10-4-2-1-3-5-10)22-15(24)16(25)23(13)9-17(19,20)21/h1-8,15,24H,9H2 |
InChiKey: | InChIKey=XQJAPOSYQSPTBY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.