* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JACOBINE |
CAS: | 6870-67-3 |
English Synonyms: | JACOBINE |
MDL Number.: | MFCD00870079 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | C[C@@H]1C[C@]2([C@@H](O2)C)C(=O)O[C@@H]3CCN4[C@@H]3C(=CC4)COC(=O)[C@]1(C)O |
InChi: | InChI=1S/C18H25NO6/c1-10-8-18(11(2)25-18)16(21)24-13-5-7-19-6-4-12(14(13)19)9-23-15(20)17(10,3)22/h4,10-11,13-14,22H,5-9H2,1-3H3/t10-,11+,13-,14-,17-,18+/m1/s1 |
InChiKey: | InChIKey=IAPHXJRHXBQDQJ-WKMWQDDRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.