* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CIS RETINOL |
CAS: | 22737-97-9 |
English Synonyms: | 9-CIS RETINOL ; 9-CIS-VITAMIN A ALCOHOL |
MDL Number.: | MFCD00870275 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C\C(=C\CO)\C)/C |
InChi: | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8-,17-13+ |
InChiKey: | InChIKey=FPIPGXGPPPQFEQ-MKOSUFFBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.