* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCOVIR |
CAS: | 131262-82-3 |
English Synonyms: | GLYCOVIR |
MDL Number.: | MFCD00870966 |
H bond acceptor: | 9 |
H bond donor: | 0 |
Smile: | CCCCN1C[C@@H]([C@H]([C@@H]([C@H]1COC(=O)CCC)OC(=O)CCC)OC(=O)CCC)OC(=O)CCC |
InChi: | InChI=1S/C26H45NO8/c1-6-11-16-27-17-20(33-22(29)13-8-3)26(35-24(31)15-10-5)25(34-23(30)14-9-4)19(27)18-32-21(28)12-7-2/h19-20,25-26H,6-18H2,1-5H3/t19-,20+,25-,26-/m1/s1 |
InChiKey: | InChIKey=MKGDNVHZSCXBKR-KYVQNOJUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.