* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XEMILOFIBAN |
| CAS: | 149820-74-6 |
| English Synonyms: | XEMILOFIBAN |
| MDL Number.: | MFCD00871094 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CCOC(=O)C[C@@H](C#C)NC(=O)CCC(=O)Nc1ccc(cc1)C(=N)N |
| InChi: | InChI=1S/C18H22N4O4/c1-3-13(11-17(25)26-4-2)21-15(23)9-10-16(24)22-14-7-5-12(6-8-14)18(19)20/h1,5-8,13H,4,9-11H2,2H3,(H3,19,20)(H,21,23)(H,22,24)/t13-/m1/s1 |
| InChiKey: | InChIKey=ZHCINJQZDFCSEL-CYBMUJFWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.