* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SEOCALCITOL |
| CAS: | 134404-52-7 |
| English Synonyms: | SEOCALCITOL |
| MDL Number.: | MFCD00871599 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | CCC(CC)(/C=C/C=C/[C@@H](C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C)O |
| InChi: | InChI=1S/C30H46O3/c1-6-30(33,7-2)18-9-8-11-21(3)26-15-16-27-23(12-10-17-29(26,27)5)13-14-24-19-25(31)20-28(32)22(24)4/h8-9,11,13-14,18,21,25-28,31-33H,4,6-7,10,12,15-17,19-20H2,1-3,5H3/b11-8+,18-9+,23-13+,24-14-/t21-,25-,26-,27+,28+,29-/m1/s1 |
| InChiKey: | InChIKey=LVLLALCJVJNGQQ-SEODYNFXSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.