* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GUANOXABENZ |
CAS: | 24047-25-4 |
English Synonyms: | GUANOXABENZ |
MDL Number.: | MFCD00871675 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | c1cc(c(c(c1)Cl)/C=N/NC(=N)NO)Cl |
InChi: | InChI=1S/C8H8Cl2N4O/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14-15/h1-4,15H,(H3,11,13,14)/b12-4+ |
InChiKey: | InChIKey=QKIQJNNDIWGVEH-UUILKARUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.