* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RIDOGREL |
CAS: | 110140-89-1 |
English Synonyms: | RIDOGREL |
MDL Number.: | MFCD00873577 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)C(F)(F)F)/C(=N\OCCCCC(=O)O)/c2cccnc2 |
InChi: | InChI=1S/C18H17F3N2O3/c19-18(20,21)15-7-3-5-13(11-15)17(14-6-4-9-22-12-14)23-26-10-2-1-8-16(24)25/h3-7,9,11-12H,1-2,8,10H2,(H,24,25)/b23-17+ |
InChiKey: | InChIKey=GLLPUTYLZIKEGF-HAVVHWLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.