* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JASPAMIDE |
| CAS: | 102396-24-7 |
| English Synonyms: | JASPLAKINOLIDE (+) ; JASPAMIDE |
| MDL Number.: | MFCD00873735 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | C[C@@H]\1C[C@@H](OC(=O)C[C@@H](NC(=O)[C@H](N(C(=O)[C@@H](NC(=O)[C@H](C/C(=C1)/C)C)C)C)Cc2c3ccccc3[nH]c2Br)c4ccc(cc4)O)C |
| InChi: | InChI=1S/C36H45BrN4O6/c1-20-15-21(2)17-23(4)47-32(43)19-30(25-11-13-26(42)14-12-25)40-35(45)31(18-28-27-9-7-8-10-29(27)39-33(28)37)41(6)36(46)24(5)38-34(44)22(3)16-20/h7-15,21-24,30-31,39,42H,16-19H2,1-6H3,(H,38,44)(H,40,45)/b20-15+/t21-,22-,23-,24-,30+,31+/m0/s1 |
| InChiKey: | InChIKey=GQWYWHOHRVVHAP-DHKPLNAMSA-N |
|
|
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.