* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WEB 2347 |
CAS: | 114800-19-0 |
English Synonyms: | WEB 2347 |
MDL Number.: | MFCD00882188 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCCN(CCC)C(=O)C1Cc2c(sc-3c2C(=NCc4n3c(nn4)C)c5ccccc5Cl)C1 |
InChi: | InChI=1S/C25H28ClN5OS/c1-4-10-30(11-5-2)24(32)16-12-18-20(13-16)33-25-22(18)23(17-8-6-7-9-19(17)26)27-14-21-29-28-15(3)31(21)25/h6-9,16H,4-5,10-14H2,1-3H3 |
InChiKey: | InChIKey=SCSIRWUYQVAIRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.