* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLENVASTATIN |
CAS: | 122254-45-9 |
English Synonyms: | GLENVASTATIN |
MDL Number.: | MFCD00887621 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)c1c(c(cc(n1)c2ccccc2)c3ccc(cc3)F)/C=C/[C@@H]4C[C@H](CC(=O)O4)O |
InChi: | InChI=1S/C27H26FNO3/c1-17(2)27-23(13-12-22-14-21(30)15-26(31)32-22)24(18-8-10-20(28)11-9-18)16-25(29-27)19-6-4-3-5-7-19/h3-13,16-17,21-22,30H,14-15H2,1-2H3/b13-12+/t21-,22-/m1/s1 |
InChiKey: | InChIKey=LJIZUXQINHXGAO-ITWZMISCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.