* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RESORTHIOMYCIN |
CAS: | 126651-92-1 |
English Synonyms: | RESORTHIOMYCIN |
MDL Number.: | MFCD00891642 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | Cc1c(c(c(c(c1O)C(=O)C)SC)CCC(C)O)O |
InChi: | InChI=1S/C14H20O4S/c1-7(15)5-6-10-12(17)8(2)13(18)11(9(3)16)14(10)19-4/h7,15,17-18H,5-6H2,1-4H3 |
InChiKey: | InChIKey=IDJZXHKJJASPKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.