* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURNIDIPINE |
CAS: | 138661-03-7 |
English Synonyms: | FURNIDIPINE |
MDL Number.: | MFCD00893003 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | CC1=C([C@H](C(=C(N1)C)C(=O)OC[C@H]2CCCO2)c3ccccc3[N+](=O)[O-])C(=O)OC |
InChi: | InChI=1S/C21H24N2O7/c1-12-17(20(24)28-3)19(15-8-4-5-9-16(15)23(26)27)18(13(2)22-12)21(25)30-11-14-7-6-10-29-14/h4-5,8-9,14,19,22H,6-7,10-11H2,1-3H3/t14-,19-/m1/s1 |
InChiKey: | InChIKey=GGVUNNUOJDGCBK-AUUYWEPGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.