* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WY 48989 |
CAS: | 136917-40-3 |
English Synonyms: | WY 48989 |
MDL Number.: | MFCD00896452 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)n2cc3c(nc4cc(ccc4c3n2)Cl)CCNc5ccc(cc5)C#N |
InChi: | InChI=1S/C25H18ClN5/c26-18-8-11-21-24(14-18)29-23(12-13-28-19-9-6-17(15-27)7-10-19)22-16-31(30-25(21)22)20-4-2-1-3-5-20/h1-11,14,16,28H,12-13H2 |
InChiKey: | InChIKey=GYVYUQVVKBZPRY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.