* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[1,2-A]PYRIDO[3,2-E]PYRAZIN-6(5H)-ONE |
CAS: | 134485-88-4 |
English Synonyms: | IMIDAZO[1,2-A]PYRIDO[3,2-E]PYRAZIN-6(5H)-ONE |
MDL Number.: | MFCD00896834 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc2c(nc1)n3ccnc3c(=O)[nH]2 |
InChi: | InChI=1S/C9H6N4O/c14-9-8-11-4-5-13(8)7-6(12-9)2-1-3-10-7/h1-5H,(H,12,14) |
InChiKey: | InChIKey=RBWPRDOIOGBINM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.