* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GAMMA-TOCOTRIENOL |
| English Synonyms: | GAMMA-TOCOTRIENOL |
| MDL Number.: | MFCD00901547 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1c(c2c(cc1O)CCC(O2)(C)CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)C |
| InChi: | InChI=1S/C28H42O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,19,29H,8-10,12,14,16-18H2,1-7H3/b21-13+,22-15+ |
| InChiKey: | InChIKey=OTXNTMVVOOBZCV-NTZRDTQNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.