* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | F-1394 |
| English Synonyms: | F-1394 |
| MDL Number.: | MFCD00903767 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CCCCCCCCCN(CC(C)(C)C)C(=O)N[C@H]1CCCC[C@@H]1OC(=O)CCNC(=O)C2C(COC(O2)(C)C)(C)C |
| InChi: | InChI=1S/C33H61N3O6/c1-9-10-11-12-13-14-17-22-36(23-31(2,3)4)30(39)35-25-18-15-16-19-26(25)41-27(37)20-21-34-29(38)28-32(5,6)24-40-33(7,8)42-28/h25-26,28H,9-24H2,1-8H3,(H,34,38)(H,35,39)/t25-,26-,28?/m0/s1 |
| InChiKey: | InChIKey=NWLFOBZKYXKBOF-QIELNMHASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.