* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCOPRIL |
CAS: | 135038-56-1 |
English Synonyms: | GLYCOPRIL |
MDL Number.: | MFCD00905022 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(=O)SC[C@@H](Cc1ccc2c(c1)OCO2)C(=O)NCC(=O)OCc3ccccc3 |
InChi: | InChI=1S/C22H23NO6S/c1-15(24)30-13-18(9-17-7-8-19-20(10-17)29-14-28-19)22(26)23-11-21(25)27-12-16-5-3-2-4-6-16/h2-8,10,18H,9,11-14H2,1H3,(H,23,26)/t18-/m1/s1 |
InChiKey: | InChIKey=IVBOFTGCTWVBLF-GOSISDBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.