* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FR 75513 |
CAS: | 127975-78-4 |
English Synonyms: | FR 75513 |
MDL Number.: | MFCD00905348 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | Cc1cc(c(c(c1C(=O)OC(C)C)c2ccccc2[N+](=O)[O-])C(=O)OC)O |
InChi: | InChI=1S/C19H19NO7/c1-10(2)27-19(23)15-11(3)9-14(21)17(18(22)26-4)16(15)12-7-5-6-8-13(12)20(24)25/h5-10,21H,1-4H3 |
InChiKey: | InChIKey=XSAOKGZBHYQDNI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.