* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KNI 102 |
| CAS: | 139694-65-8 |
| English Synonyms: | KNI 102 |
| MDL Number.: | MFCD00906181 |
| H bond acceptor: | 12 |
| H bond donor: | 5 |
| Smile: | CC(C)(C)NC(=O)[C@@H]1CCCN1C(=O)[C@H]([C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)N)NC(=O)OCc3ccccc3)O |
| InChi: | InChI=1S/C31H41N5O7/c1-31(2,3)35-28(40)24-15-10-16-36(24)29(41)26(38)22(17-20-11-6-4-7-12-20)33-27(39)23(18-25(32)37)34-30(42)43-19-21-13-8-5-9-14-21/h4-9,11-14,22-24,26,38H,10,15-19H2,1-3H3,(H2,32,37)(H,33,39)(H,34,42)(H,35,40)/t22-,23-,24-,26-/m0/s1 |
| InChiKey: | InChIKey=XCVUOCMQYKSJJR-IGRGDXOOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.