* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GP 531 |
CAS: | 142344-87-4 |
English Synonyms: | GP 531 |
MDL Number.: | MFCD00910974 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | c1ccc(cc1)CNC[C@@H]2[C@H]([C@H]([C@@H](O2)n3cnc(c3N)C(=O)N)O)O |
InChi: | InChI=1S/C16H21N5O4/c17-14-11(15(18)24)20-8-21(14)16-13(23)12(22)10(25-16)7-19-6-9-4-2-1-3-5-9/h1-5,8,10,12-13,16,19,22-23H,6-7,17H2,(H2,18,24)/t10-,12-,13-,16-/m1/s1 |
InChiKey: | InChIKey=LECUGLHMNZTZQB-XNIJJKJLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.