* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 33377 |
CAS: | 146537-07-7 |
English Synonyms: | WIN 33377 |
MDL Number.: | MFCD00915981 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCN(CC)CCNc1ccc(c2c1c(=O)c3ccccc3s2)CNS(=O)(=O)C |
InChi: | InChI=1S/C21H27N3O3S2/c1-4-24(5-2)13-12-22-17-11-10-15(14-23-29(3,26)27)21-19(17)20(25)16-8-6-7-9-18(16)28-21/h6-11,22-23H,4-5,12-14H2,1-3H3 |
InChiKey: | InChIKey=NAMOLZVVTPNNTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.