* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JUSTICIDIN G |
| CAS: | 145971-08-0 |
| English Synonyms: | JUSTICIDIN G |
| MDL Number.: | MFCD00916466 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | COc1cc2c(cc1OC)c(c3c(c2c4cc5c(cc4O)OCO5)C(=O)OC3)OC |
| InChi: | InChI=1S/C22H18O8/c1-25-15-4-10-11(5-16(15)26-2)21(27-3)13-8-28-22(24)20(13)19(10)12-6-17-18(7-14(12)23)30-9-29-17/h4-7,23H,8-9H2,1-3H3 |
| InChiKey: | InChIKey=DFVZQTUMRRMHEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.