* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FROVATRIPTAN |
CAS: | 147009-08-3 |
English Synonyms: | FROVATRIPTAN |
MDL Number.: | MFCD00919232 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CNC1CCc2c(c3cc(ccc3[nH]2)C(=O)N)C1 |
InChi: | InChI=1S/C14H17N3O/c1-16-9-3-5-13-11(7-9)10-6-8(14(15)18)2-4-12(10)17-13/h2,4,6,9,16-17H,3,5,7H2,1H3,(H2,15,18) |
InChiKey: | InChIKey=XPSQPHWEGNHMSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.