* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FG 5865 |
CAS: | 150527-35-8 |
English Synonyms: | FG 5865 |
MDL Number.: | MFCD00921900 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(c(nc1)N2CCN(CC2)CCCC(c3ccc(cc3)F)c4ccc(cc4)F)C(=O)N.Cl |
InChi: | InChI=1S/C26H28F2N4O.ClH/c27-21-9-5-19(6-10-21)23(20-7-11-22(28)12-8-20)4-2-14-31-15-17-32(18-16-31)26-24(25(29)33)3-1-13-30-26;/h1,3,5-13,23H,2,4,14-18H2,(H2,29,33);1H |
InChiKey: | InChIKey=NLQPRLIEAIIDAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.