* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN-64338 |
English Synonyms: | WIN-64338 |
MDL Number.: | MFCD00922639 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | Cl.[Cl-].CCCC[P+](CCCC)(CCCC)CC1=CC=C(NC(=O)C(CC2=CC3=C(C=CC=C3)C=C2)N=C(NC2CCCCC2)NC2CCCCC2)C=C1 |
InChi: | InChI=1S/C45H67N4OP.2ClH/c1-4-7-30-51(31-8-5-2,32-9-6-3)35-36-25-28-42(29-26-36)46-44(50)43(34-37-24-27-38-18-16-17-19-39(38)33-37)49-45(47-40-20-12-10-13-21-40)48-41-22-14-11-15-23-41;;/h16-19,24-29,33,40-41,43H,4-15,20-23,30-32,34-35H2,1-3H3,(H2-,46,47,48,49,50);2*1H |
InChiKey: | InChIKey=YYJGBEZPVOUBMJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.