* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | W 77 |
CAS: | 118998-51-9 |
English Synonyms: | W 77 |
MDL Number.: | MFCD00923841 |
H bond acceptor: | 10 |
H bond donor: | 1 |
Smile: | CN(C(Cc1ccc(cc1)OC)CN2CCN(CC2)C(=O)OCc3ccccc3)S(=O)(=O)c4ccc(cc4)OCCN |
InChi: | InChI=1S/C31H40N4O6S/c1-33(42(37,38)30-14-12-29(13-15-30)40-21-16-32)27(22-25-8-10-28(39-2)11-9-25)23-34-17-19-35(20-18-34)31(36)41-24-26-6-4-3-5-7-26/h3-15,27H,16-24,32H2,1-2H3 |
InChiKey: | InChIKey=JFROHKDWBGWDIE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.