* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WOODORIEN |
CAS: | 155112-92-8 |
English Synonyms: | WOODORIEN |
MDL Number.: | MFCD00924330 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | COC(=O)c1ccc(c(c1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
InChi: | InChI=1S/C14H18O9/c1-21-13(20)6-2-3-7(16)8(4-6)22-14-12(19)11(18)10(17)9(5-15)23-14/h2-4,9-12,14-19H,5H2,1H3/t9-,10-,11+,12-,14-/m1/s1 |
InChiKey: | InChIKey=PXDASGXIBCEXNH-YGEZULPYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.