* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZENIL |
CAS: | 151271-08-8 |
English Synonyms: | IMIDAZENIL |
MDL Number.: | MFCD00924519 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)C2=NCc3c(ncn3-c4c2cc(cc4)F)C(=O)N)Br |
InChi: | InChI=1S/C18H12BrFN4O/c19-13-4-2-1-3-11(13)16-12-7-10(20)5-6-14(12)24-9-23-17(18(21)25)15(24)8-22-16/h1-7,9H,8H2,(H2,21,25) |
InChiKey: | InChIKey=OCJHYHKWUWSHEN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.