* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RE 80 |
| CAS: | 116193-60-3 |
| English Synonyms: | RE 80 |
| MDL Number.: | MFCD00926027 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC1(CCC(c2c1cc(c(c2)O)C(=O)/C=C(/c3ccc(cc3)C(=O)O)\O)(C)C)C |
| InChi: | InChI=1S/C24H26O5/c1-23(2)9-10-24(3,4)18-12-20(26)16(11-17(18)23)21(27)13-19(25)14-5-7-15(8-6-14)22(28)29/h5-8,11-13,25-26H,9-10H2,1-4H3,(H,28,29)/b19-13- |
| InChiKey: | InChIKey=PZYFNWUXYUMHGR-UYRXBGFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.