* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCE 28260 |
| CAS: | 155651-56-2 |
| English Synonyms: | FCE 28260 |
| MDL Number.: | MFCD00927806 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)NC(C)(c4ccccc4)C(F)(F)F)CC[C@@H]5[C@@]3(C=CC(=O)N5)C |
| InChi: | InChI=1S/C28H35F3N2O2/c1-25-15-13-20-18(9-12-22-26(20,2)16-14-23(34)32-22)19(25)10-11-21(25)24(35)33-27(3,28(29,30)31)17-7-5-4-6-8-17/h4-8,14,16,18-22H,9-13,15H2,1-3H3,(H,32,34)(H,33,35)/t18-,19-,20-,21+,22+,25-,26+,27?/m0/s1 |
| InChiKey: | InChIKey=FAIZUAWLKOHMOP-ZOIXLQFFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.