* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GYPSETIN |
CAS: | 155114-38-8 |
English Synonyms: | GYPSETIN |
MDL Number.: | MFCD00928761 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | CC(C)(C=C)[C@]12[C@](C[C@@H]3N1C(=O)[C@@H]4C[C@]5(c6ccccc6N[C@]5(N4C3=O)C(C)(C)C=C)O)(c7ccccc7N2)O |
InChi: | InChI=1S/C32H36N4O4/c1-7-27(3,4)31-29(39,19-13-9-11-15-21(19)33-31)17-23-26(38)36-24(25(37)35(23)31)18-30(40)20-14-10-12-16-22(20)34-32(30,36)28(5,6)8-2/h7-16,23-24,33-34,39-40H,1-2,17-18H2,3-6H3/t23-,24-,29-,30+,31+,32-/m0/s1 |
InChiKey: | InChIKey=CXDDBHFLLPBKRS-OVYULKEKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.