* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FINROZOLE |
CAS: | 204714-56-7 |
English Synonyms: | FINROZOLE |
MDL Number.: | MFCD00930856 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CC(C(c2ccc(cc2)C#N)n3cncn3)O)F |
InChi: | InChI=1S/C18H15FN4O/c19-16-7-3-13(4-8-16)9-17(24)18(23-12-21-11-22-23)15-5-1-14(10-20)2-6-15/h1-8,11-12,17-18,24H,9H2 |
InChiKey: | InChIKey=SLJZVZKQYSKYNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.