* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WS 79089A |
CAS: | 157110-23-1 |
English Synonyms: | WS 79089A |
MDL Number.: | MFCD00931423 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | CC1Cc2cc3c(c(c2C(=O)O1)O)-c4c(c(c5c(c4O)C(=O)c6cccc(c6C5=O)O)OC)C(C3)O |
InChi: | InChI=1S/C27H20O9/c1-9-6-10-7-11-8-14(29)18-19(15(11)23(31)16(10)27(34)36-9)25(33)20-21(26(18)35-2)24(32)17-12(22(20)30)4-3-5-13(17)28/h3-5,7,9,14,28-29,31,33H,6,8H2,1-2H3 |
InChiKey: | InChIKey=HRWPMELFEHBAIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.