* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GR-196429 |
CAS: | 170729-12-1 |
English Synonyms: | GR-196429 ; N-[2-(2,3,7,8-TETRAHYDRO-1H-FURO[2,3-G]INDOL-1-YL)ETHYL]ACETAMIDE |
MDL Number.: | MFCD00940454 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(=O)NCCN1CCc2c1c3c(cc2)OCC3 |
InChi: | InChI=1S/C14H18N2O2/c1-10(17)15-6-8-16-7-4-11-2-3-13-12(14(11)16)5-9-18-13/h2-3H,4-9H2,1H3,(H,15,17) |
InChiKey: | InChIKey=LTYWTNUOUBBVNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.