* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WDUO-3 |
English Synonyms: | WDUO-3 |
MDL Number.: | MFCD00940477 |
H bond acceptor: | 12 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)C(=O)N(C2=O)CO/N=C/c3cc[n+](cc3)CCC[n+]4ccc(cc4)/C=N/OCN5C(=O)c6ccccc6C5=O.[Br-].[Br-] |
InChi: | InChI=1S/C33H28N6O6.2BrH/c40-30-26-6-1-2-7-27(26)31(41)38(30)22-44-34-20-24-10-16-36(17-11-24)14-5-15-37-18-12-25(13-19-37)21-35-45-23-39-32(42)28-8-3-4-9-29(28)33(39)43;;/h1-4,6-13,16-21H,5,14-15,22-23H2;2*1H/q+2;;/p-2/b34-20+,35-21+;; |
InChiKey: | InChIKey=HAHBKBPXAJTYTR-WBFMKILXSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.