* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GW-5823 |
| English Synonyms: | GW-5823 |
| MDL Number.: | MFCD00949074 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CC(C)N(c1ccc(cc1)OC)C(=O)CN2c3ccccc3N(C(=O)C(C2=O)Cc4c5ccccc5[nH]n4)c6ccccc6 |
| InChi: | InChI=1S/C35H33N5O4/c1-23(2)39(25-17-19-26(44-3)20-18-25)33(41)22-38-31-15-9-10-16-32(31)40(24-11-5-4-6-12-24)35(43)28(34(38)42)21-30-27-13-7-8-14-29(27)36-37-30/h4-20,23,28H,21-22H2,1-3H3,(H,36,37) |
| InChiKey: | InChIKey=LGYKPDHARJMLQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.